C14H14BrNO3S2 — CID 3240858
3-(4-bromophenyl)sulfonyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 3240858) has the molecular formula C14H14BrNO3S2 and a molecular weight of 388.31 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfonyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(4-bromophenyl)sulfonyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 3240858 |
| Molecular Formula | C14H14BrNO3S2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 3-(4-bromophenyl)sulfonyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(Br)cc1)NCc1cccs1 |
| InChI | InChI=1S/C14H14BrNO3S2/c15-11-3-5-13(6-4-11)21(18,19)9-7-14(17)16-10-12-2-1-8-20-12/h1-6,8H,7,9-10H2,(H,16,17) |
| InChIKey | PGBJDOCJZGEQEM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |