C25H24N4O2 — CID 3241670
N-[4-(dimethylamino)phenyl]-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetamide (PubChem CID 3241670) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetamide |
|---|---|
| PubChem CID | 3241670 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CN2C(=O)CN=C(c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-28(2)20-14-12-19(13-15-20)27-23(30)17-29-22-11-7-6-10-21(22)25(26-16-24(29)31)18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3,(H,27,30) |
| InChIKey | INHKRAUHZHFOQE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|