C15H15NO4S — CID 3242317
3-(4-methoxyphenyl)-3-(thiophene-2-carbonylamino)propanoic acid (PubChem CID 3242317) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-3-(thiophene-2-carbonylamino)propanoic acid.
| Compound Name | 3-(4-methoxyphenyl)-3-(thiophene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 3242317 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-(4-methoxyphenyl)-3-(thiophene-2-carbonylamino)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H15NO4S/c1-20-11-6-4-10(5-7-11)12(9-14(17)18)16-15(19)13-3-2-8-21-13/h2-8,12H,9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | JNELHVARRDZWTP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |