C20H20N2O6 — CID 3242624
N,5-bis(3,4-dimethoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 3242624) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is N,5-bis(3,4-dimethoxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N,5-bis(3,4-dimethoxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 3242624 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N,5-bis(3,4-dimethoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(-c3ccc(OC)c(OC)c3)on2)cc1OC |
| InChI | InChI=1S/C20H20N2O6/c1-24-15-7-5-12(9-18(15)26-3)17-11-14(22-28-17)20(23)21-13-6-8-16(25-2)19(10-13)27-4/h5-11H,1-4H3,(H,21,23) |
| InChIKey | DOYDIEWICLNTSA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |