C18H17N3O2S2 — CID 3242703
2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-thiophen-2-ylethanone (PubChem CID 3242703) has the molecular formula C18H17N3O2S2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-thiophen-2-ylethanone.
| Compound Name | 2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 3242703 |
| Molecular Formula | C18H17N3O2S2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-thiophen-2-ylethanone |
| SMILES | C=CCn1c(SCC(=O)c2cccs2)nnc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C18H17N3O2S2/c1-3-9-21-17(13-6-4-7-14(11-13)23-2)19-20-18(21)25-12-15(22)16-8-5-10-24-16/h3-8,10-11H,1,9,12H2,2H3 |
| InChIKey | UJQFXRIIFNMJQR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|