C20H18N3O3S- — CID 7722235
4-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate (PubChem CID 7722235) has the molecular formula C20H18N3O3S- and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate.
| Compound Name | 4-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7722235 |
| Molecular Formula | C20H18N3O3S- |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
| SMILES | C=CCn1c(SCc2ccc(C(=O)[O-])cc2)nnc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C20H19N3O3S/c1-3-11-23-18(16-5-4-6-17(12-16)26-2)21-22-20(23)27-13-14-7-9-15(10-8-14)19(24)25/h3-10,12H,1,11,13H2,2H3,(H,24,25)/p-1 |
| InChIKey | DXSTUDXHNNPQPS-UHFFFAOYSA-M |
| XLogP | 2.80 |
| TPSA | 80.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|