C27H25FN4O2S — CID 83284736
N-[(4-fluorophenyl)methyl]-2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide (PubChem CID 83284736) has the molecular formula C27H25FN4O2S and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 83284736 |
| Molecular Formula | C27H25FN4O2S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
| SMILES | C=CCn1c(SCc2ccccc2C(=O)NCc2ccc(F)cc2)nnc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C27H25FN4O2S/c1-3-15-32-25(20-8-6-9-23(16-20)34-2)30-31-27(32)35-18-21-7-4-5-10-24(21)26(33)29-17-19-11-13-22(28)14-12-19/h3-14,16H,1,15,17-18H2,2H3,(H,29,33) |
| InChIKey | OLKCIULTFMDKNL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|