C14H15NO3S — CID 3244042
ethyl 3-oxo-4-prop-2-enyl-1,4-benzothiazine-6-carboxylate (PubChem CID 3244042) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is ethyl 3-oxo-4-prop-2-enyl-1,4-benzothiazine-6-carboxylate.
| Compound Name | ethyl 3-oxo-4-prop-2-enyl-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 3244042 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | ethyl 3-oxo-4-prop-2-enyl-1,4-benzothiazine-6-carboxylate |
| SMILES | C=CCN1C(=O)CSc2ccc(C(=O)OCC)cc21 |
| InChI | InChI=1S/C14H15NO3S/c1-3-7-15-11-8-10(14(17)18-4-2)5-6-12(11)19-9-13(15)16/h3,5-6,8H,1,4,7,9H2,2H3 |
| InChIKey | IKMHRGFIIBEPQU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|