C17H11N3O2S — CID 3244574
N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]furan-2-carboxamide (PubChem CID 3244574) has the molecular formula C17H11N3O2S and a molecular weight of 321.36 g/mol. Its IUPAC name is N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3244574 |
| Molecular Formula | C17H11N3O2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nc3cccnc3s2)c1)c1ccco1 |
| InChI | InChI=1S/C17H11N3O2S/c21-15(14-7-3-9-22-14)19-12-5-1-4-11(10-12)16-20-13-6-2-8-18-17(13)23-16/h1-10H,(H,19,21) |
| InChIKey | YTYJMRRWOZWRGD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |