C14H14ClNO3S — CID 3244639
ethyl 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanylacetate (PubChem CID 3244639) has the molecular formula C14H14ClNO3S and a molecular weight of 311.79 g/mol. Its IUPAC name is ethyl 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanylacetate.
| Compound Name | ethyl 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3244639 |
| Molecular Formula | C14H14ClNO3S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | ethyl 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1cc(=O)n(C)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H14ClNO3S/c1-3-19-14(18)8-20-12-7-13(17)16(2)11-6-9(15)4-5-10(11)12/h4-7H,3,8H2,1-2H3 |
| InChIKey | UPYIQSPMXJQISB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |