C19H24ClN3O3S — CID 3245470
2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanyl-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 3245470) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanyl-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanyl-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 3245470 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanyl-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | Cn1c(=O)cc(SCC(=O)NCCCN2CCOCC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H24ClN3O3S/c1-22-16-11-14(20)3-4-15(16)17(12-19(22)25)27-13-18(24)21-5-2-6-23-7-9-26-10-8-23/h3-4,11-12H,2,5-10,13H2,1H3,(H,21,24) |
| InChIKey | LFIGOPUQSSVGOM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|