C20H23NO2 — CID 3246488
(2S,3S)-2-methyl-3-morpholin-4-yl-1,3-diphenylpropan-1-one (PubChem CID 3246488) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-morpholin-4-yl-1,3-diphenylpropan-1-one.
| Compound Name | (2S,3S)-2-methyl-3-morpholin-4-yl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 3246488 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2S,3S)-2-methyl-3-morpholin-4-yl-1,3-diphenylpropan-1-one |
| SMILES | C[C@H](C(=O)c1ccccc1)[C@@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H23NO2/c1-16(20(22)18-10-6-3-7-11-18)19(17-8-4-2-5-9-17)21-12-14-23-15-13-21/h2-11,16,19H,12-15H2,1H3/t16-,19-/m0/s1 |
| InChIKey | RUSXYSPNUUXXDR-LPHOPBHVSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |