C11H13N3O2 — CID 3246788
N-(3-imidazol-1-ylpropyl)furan-2-carboxamide (PubChem CID 3246788) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)furan-2-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3246788 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)furan-2-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccco1 |
| InChI | InChI=1S/C11H13N3O2/c15-11(10-3-1-8-16-10)13-4-2-6-14-7-5-12-9-14/h1,3,5,7-9H,2,4,6H2,(H,13,15) |
| InChIKey | SJCOIXPRMXVMDX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|