C25H27N7O3S2 — CID 3249828
methyl 2-[[2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 3249828) has the molecular formula C25H27N7O3S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3249828 |
| Molecular Formula | C25H27N7O3S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | methyl 2-[[2-[[5-(benzotriazol-1-ylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | C=CCn1c(Cn2nnc3ccccc32)nnc1SCC(=O)Nc1sc2c(c1C(=O)OC)CCCCC2 |
| InChI | InChI=1S/C25H27N7O3S2/c1-3-13-31-20(14-32-18-11-8-7-10-17(18)27-30-32)28-29-25(31)36-15-21(33)26-23-22(24(34)35-2)16-9-5-4-6-12-19(16)37-23/h3,7-8,10-11H,1,4-6,9,12-15H2,2H3,(H,26,33) |
| InChIKey | MWMSLMZJAVINKX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|