C13H23N3O3S — CID 32501701
4-[(1R)-cyclohex-3-ene-1-carbonyl]-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 32501701) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-[(1R)-cyclohex-3-ene-1-carbonyl]-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-[(1R)-cyclohex-3-ene-1-carbonyl]-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 32501701 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-[(1R)-cyclohex-3-ene-1-carbonyl]-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)[C@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C13H23N3O3S/c1-14(2)20(18,19)16-10-8-15(9-11-16)13(17)12-6-4-3-5-7-12/h3-4,12H,5-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | JCAMGHSRBHHCLU-LBPRGKRZSA-N |
| XLogP | 0.29 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|