C22H23FN4O4S — CID 32512650
N-[1-[4-(2-cyanoethylsulfamoyl)benzoyl]piperidin-4-yl]-4-fluorobenzamide (PubChem CID 32512650) has the molecular formula C22H23FN4O4S and a molecular weight of 458.52 g/mol. Its IUPAC name is N-[1-[4-(2-cyanoethylsulfamoyl)benzoyl]piperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[4-(2-cyanoethylsulfamoyl)benzoyl]piperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 32512650 |
| Molecular Formula | C22H23FN4O4S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-[1-[4-(2-cyanoethylsulfamoyl)benzoyl]piperidin-4-yl]-4-fluorobenzamide |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)N2CCC(NC(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H23FN4O4S/c23-18-6-2-16(3-7-18)21(28)26-19-10-14-27(15-11-19)22(29)17-4-8-20(9-5-17)32(30,31)25-13-1-12-24/h2-9,19,25H,1,10-11,13-15H2,(H,26,28) |
| InChIKey | KMZLVYBQXWFGNV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|