C20H22N2O5 — CID 32516391
4,5-dimethoxy-N,N-dimethyl-2-[[2-(4-methylphenyl)-2-oxoacetyl]amino]benzamide (PubChem CID 32516391) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4,5-dimethoxy-N,N-dimethyl-2-[[2-(4-methylphenyl)-2-oxoacetyl]amino]benzamide.
| Compound Name | 4,5-dimethoxy-N,N-dimethyl-2-[[2-(4-methylphenyl)-2-oxoacetyl]amino]benzamide |
|---|---|
| PubChem CID | 32516391 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4,5-dimethoxy-N,N-dimethyl-2-[[2-(4-methylphenyl)-2-oxoacetyl]amino]benzamide |
| SMILES | COc1cc(NC(=O)C(=O)c2ccc(C)cc2)c(C(=O)N(C)C)cc1OC |
| InChI | InChI=1S/C20H22N2O5/c1-12-6-8-13(9-7-12)18(23)19(24)21-15-11-17(27-5)16(26-4)10-14(15)20(25)22(2)3/h6-11H,1-5H3,(H,21,24) |
| InChIKey | FIQRFZQYNMPMAV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|