C20H20N4O6 — CID 32516317
N-[2-(dimethylcarbamoyl)-4,5-dimethoxyphenyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 32516317) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoyl)-4,5-dimethoxyphenyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-[2-(dimethylcarbamoyl)-4,5-dimethoxyphenyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 32516317 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[2-(dimethylcarbamoyl)-4,5-dimethoxyphenyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)c(C(=O)N(C)C)cc1OC |
| InChI | InChI=1S/C20H20N4O6/c1-24(2)20(28)11-8-15(29-3)16(30-4)9-13(11)22-17(25)10-5-6-12-14(7-10)23-19(27)18(26)21-12/h5-9H,1-4H3,(H,21,26)(H,22,25)(H,23,27) |
| InChIKey | XFKBHWMWGITYBS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|