C16H24ClN2O2+ — CID 3251737
1-(4-butan-2-ylpiperazin-4-ium-1-yl)-2-(4-chlorophenoxy)ethanone (PubChem CID 3251737) has the molecular formula C16H24ClN2O2+ and a molecular weight of 311.83 g/mol. Its IUPAC name is 1-(4-butan-2-ylpiperazin-4-ium-1-yl)-2-(4-chlorophenoxy)ethanone.
| Compound Name | 1-(4-butan-2-ylpiperazin-4-ium-1-yl)-2-(4-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 3251737 |
| Molecular Formula | C16H24ClN2O2+ |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-(4-butan-2-ylpiperazin-4-ium-1-yl)-2-(4-chlorophenoxy)ethanone |
| SMILES | CCC(C)[NH+]1CCN(C(=O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-3-13(2)18-8-10-19(11-9-18)16(20)12-21-15-6-4-14(17)5-7-15/h4-7,13H,3,8-12H2,1-2H3/p+1 |
| InChIKey | KXBHTZYDYCXWQJ-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |