C16H20ClN3O2 — CID 51091678
3-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]butanenitrile (PubChem CID 51091678) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 3-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]butanenitrile.
| Compound Name | 3-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 51091678 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]butanenitrile |
| SMILES | CC(CC#N)N1CCN(C(=O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-13(6-7-18)19-8-10-20(11-9-19)16(21)12-22-15-4-2-14(17)3-5-15/h2-5,13H,6,8-12H2,1H3 |
| InChIKey | LUGYWMVKFMIGEK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |