C23H19FN2O3 — CID 32519552
3-[(2R)-2-(4-fluorophenyl)-2-hydroxyethyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 32519552) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is 3-[(2R)-2-(4-fluorophenyl)-2-hydroxyethyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[(2R)-2-(4-fluorophenyl)-2-hydroxyethyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 32519552 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-[(2R)-2-(4-fluorophenyl)-2-hydroxyethyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1C[C@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19FN2O3/c24-19-13-11-16(12-14-19)20(27)15-26-21(28)23(25-22(26)29,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,20,27H,15H2,(H,25,29)/t20-/m0/s1 |
| InChIKey | SLZDQZPPFBVBKO-FQEVSTJZSA-N |
| XLogP | 3.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|