C5H8N4S — CID 3252085
2,5-diamino-6-methyl-1H-pyrimidine-4-thione (PubChem CID 3252085) has the molecular formula C5H8N4S and a molecular weight of 156.21 g/mol. Its IUPAC name is 2,5-diamino-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | 2,5-diamino-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 3252085 |
| Molecular Formula | C5H8N4S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2,5-diamino-6-methyl-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(N)nc(=S)c1N |
| InChI | InChI=1S/C5H8N4S/c1-2-3(6)4(10)9-5(7)8-2/h6H2,1H3,(H3,7,8,9,10) |
| InChIKey | PMMBEEJWQYHVNO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|