About 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione
2-amino-5,6-dimethyl-1H-pyrimidine-4-thione (PubChem CID 45071863) has the molecular formula C6H9N3S
and a molecular weight of 155.23 g/mol. Its IUPAC name is 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione |
| PubChem CID | 45071863 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(N)nc(=S)c1C |
| InChI | InChI=1S/C6H9N3S/c1-3-4(2)8-6(7)9-5(3)10/h1-2H3,(H3,7,8,9,10) |
| InChIKey | TXMPQVVMSAPEIF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione?
The IUPAC name of 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione (CID 45071863) is 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione.
What is the SMILES notation for 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione?
The canonical SMILES for 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione is Cc1[nH]c(N)nc(=S)c1C.
What is the InChIKey of 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione?
The InChIKey is TXMPQVVMSAPEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S/c1-3-4(2)8-6(7)9-5(3)10/h1-2H3,(H3,7,8,9,10).
What are the key properties of 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione?
2-amino-5,6-dimethyl-1H-pyrimidine-4-thione has a molecular weight of 155.23 g/mol, XLogP of 1.34, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,6-dimethyl-1H-pyrimidine-4-thione is sourced from PubChem (CID 45071863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).