C24H19FN2O6 — CID 3254109
[4-[(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] 2-fluorobenzoate (PubChem CID 3254109) has the molecular formula C24H19FN2O6 and a molecular weight of 450.42 g/mol. Its IUPAC name is [4-[(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] 2-fluorobenzoate.
| Compound Name | [4-[(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 3254109 |
| Molecular Formula | C24H19FN2O6 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [4-[(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]-2-methoxyphenyl] 2-fluorobenzoate |
| SMILES | COc1cc(C=NNC(=O)C2COc3ccccc3O2)ccc1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C24H19FN2O6/c1-30-21-12-15(10-11-20(21)33-24(29)16-6-2-3-7-17(16)25)13-26-27-23(28)22-14-31-18-8-4-5-9-19(18)32-22/h2-13,22H,14H2,1H3,(H,27,28) |
| InChIKey | RYRJNJIFVUUGDP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|