C26H24N2O8 — CID 25251508
[2-[(E)-(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 25251508) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is [2-[(E)-(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(E)-(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 25251508 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [2-[(E)-(2,3-dihydro-1,4-benzodioxine-3-carbonylhydrazinylidene)methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccccc2/C=N/NC(=O)C2COc3ccccc3O2)cc(OC)c1OC |
| InChI | InChI=1S/C26H24N2O8/c1-31-21-12-17(13-22(32-2)24(21)33-3)26(30)36-18-9-5-4-8-16(18)14-27-28-25(29)23-15-34-19-10-6-7-11-20(19)35-23/h4-14,23H,15H2,1-3H3,(H,28,29)/b27-14+ |
| InChIKey | FEGRDNCDCXILCX-MZJWZYIUSA-N |
| XLogP | 3.22 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|