C19H17N2O7- — CID 8974652
6-[(Z)-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoate (PubChem CID 8974652) has the molecular formula C19H17N2O7- and a molecular weight of 385.35 g/mol. Its IUPAC name is 6-[(Z)-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoate.
| Compound Name | 6-[(Z)-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 8974652 |
| Molecular Formula | C19H17N2O7- |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 6-[(Z)-[[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-2,3-dimethoxybenzoate |
| SMILES | COc1ccc(/C=N\NC(=O)[C@H]2COc3ccccc3O2)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C19H18N2O7/c1-25-14-8-7-11(16(19(23)24)17(14)26-2)9-20-21-18(22)15-10-27-12-5-3-4-6-13(12)28-15/h3-9,15H,10H2,1-2H3,(H,21,22)(H,23,24)/p-1/b20-9-/t15-/m1/s1 |
| InChIKey | QVWNVDIPKLBWGI-WJHPISCYSA-M |
| XLogP | 0.36 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|