C20H18N3O7- — CID 8982308
2,3-dimethoxy-6-[(Z)-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 8982308) has the molecular formula C20H18N3O7- and a molecular weight of 412.38 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 2,3-dimethoxy-6-[(Z)-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 8982308 |
| Molecular Formula | C20H18N3O7- |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COc1ccc(/C=N\NC(=O)CN2C(=O)COc3ccccc32)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C20H19N3O7/c1-28-15-8-7-12(18(20(26)27)19(15)29-2)9-21-22-16(24)10-23-13-5-3-4-6-14(13)30-11-17(23)25/h3-9H,10-11H2,1-2H3,(H,22,24)(H,26,27)/p-1/b21-9- |
| InChIKey | PPNHBNCKJLVJNN-NKVSQWTQSA-M |
| XLogP | -0.06 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|