C18H17ClN4O2 — CID 3255837
2-amino-4-(2-chloro-5-nitrophenyl)-6-ethyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 3255837) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-amino-4-(2-chloro-5-nitrophenyl)-6-ethyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(2-chloro-5-nitrophenyl)-6-ethyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 3255837 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-amino-4-(2-chloro-5-nitrophenyl)-6-ethyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CCC1CCc2nc(N)c(C#N)c(-c3cc([N+](=O)[O-])ccc3Cl)c2C1 |
| InChI | InChI=1S/C18H17ClN4O2/c1-2-10-3-6-16-13(7-10)17(14(9-20)18(21)22-16)12-8-11(23(24)25)4-5-15(12)19/h4-5,8,10H,2-3,6-7H2,1H3,(H2,21,22) |
| InChIKey | LLJUQSFFUUFWEK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|