C20H16ClN3O2 — CID 3256701
2-(4-chlorophenoxy)-N-[[phenyl(pyridin-2-yl)methylidene]amino]acetamide (PubChem CID 3256701) has the molecular formula C20H16ClN3O2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[phenyl(pyridin-2-yl)methylidene]amino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[phenyl(pyridin-2-yl)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 3256701 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[phenyl(pyridin-2-yl)methylidene]amino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NN=C(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C20H16ClN3O2/c21-16-9-11-17(12-10-16)26-14-19(25)23-24-20(15-6-2-1-3-7-15)18-8-4-5-13-22-18/h1-13H,14H2,(H,23,25) |
| InChIKey | KMXJYWKKIUKUTO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|