C23H19NO5S — CID 3257855
1-(furan-2-ylmethyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3257855) has the molecular formula C23H19NO5S and a molecular weight of 421.47 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-(furan-2-ylmethyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3257855 |
| Molecular Formula | C23H19NO5S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 1-(furan-2-ylmethyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1cccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2Cc2ccco2)c1 |
| InChI | InChI=1S/C23H19NO5S/c1-2-10-28-16-7-3-6-15(13-16)20-19(21(25)18-9-5-12-30-18)22(26)23(27)24(20)14-17-8-4-11-29-17/h2-9,11-13,20,26H,1,10,14H2 |
| InChIKey | GIPRAVWXMZICKZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|