C38H46N2O3 — CID 3258544
3'-benzoyl-5'-butyl-1'-decanoyl-4'-phenylspiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 3258544) has the molecular formula C38H46N2O3 and a molecular weight of 578.80 g/mol. Its IUPAC name is 3'-benzoyl-5'-butyl-1'-decanoyl-4'-phenylspiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | 3'-benzoyl-5'-butyl-1'-decanoyl-4'-phenylspiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 3258544 |
| Molecular Formula | C38H46N2O3 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | 3'-benzoyl-5'-butyl-1'-decanoyl-4'-phenylspiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | CCCCCCCCCC(=O)N1C(CCCC)C(c2ccccc2)C(C(=O)c2ccccc2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C38H46N2O3/c1-3-5-7-8-9-10-17-27-33(41)40-32(26-6-4-2)34(28-20-13-11-14-21-28)35(36(42)29-22-15-12-16-23-29)38(40)30-24-18-19-25-31(30)39-37(38)43/h11-16,18-25,32,34-35H,3-10,17,26-27H2,1-2H3,(H,39,43) |
| InChIKey | AVACDUKBMQIAFY-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|