C14H21N3O2S — CID 32597617
(3S)-3-N-[(2S)-1-thiophen-2-ylpropan-2-yl]piperidine-1,3-dicarboxamide (PubChem CID 32597617) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is (3S)-3-N-[(2S)-1-thiophen-2-ylpropan-2-yl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[(2S)-1-thiophen-2-ylpropan-2-yl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 32597617 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (3S)-3-N-[(2S)-1-thiophen-2-ylpropan-2-yl]piperidine-1,3-dicarboxamide |
| SMILES | C[C@@H](Cc1cccs1)NC(=O)[C@H]1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C14H21N3O2S/c1-10(8-12-5-3-7-20-12)16-13(18)11-4-2-6-17(9-11)14(15)19/h3,5,7,10-11H,2,4,6,8-9H2,1H3,(H2,15,19)(H,16,18)/t10-,11-/m0/s1 |
| InChIKey | VRGGGXWSVNYVEU-QWRGUYRKSA-N |
| XLogP | 1.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |