C17H19N3O5S — CID 3263566
1-(benzenesulfonyl)-3-[(4-methoxy-2-methylphenyl)carbamoyl]-1-methylurea (PubChem CID 3263566) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-[(4-methoxy-2-methylphenyl)carbamoyl]-1-methylurea.
| Compound Name | 1-(benzenesulfonyl)-3-[(4-methoxy-2-methylphenyl)carbamoyl]-1-methylurea |
|---|---|
| PubChem CID | 3263566 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-(benzenesulfonyl)-3-[(4-methoxy-2-methylphenyl)carbamoyl]-1-methylurea |
| SMILES | COc1ccc(NC(=O)NC(=O)N(C)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C17H19N3O5S/c1-12-11-13(25-3)9-10-15(12)18-16(21)19-17(22)20(2)26(23,24)14-7-5-4-6-8-14/h4-11H,1-3H3,(H2,18,19,21,22) |
| InChIKey | XHRDVVCOEKBPSY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |