C21H19NO3S — CID 3265558
2-(4-methylphenyl)sulfonyl-N,N-diphenylacetamide (PubChem CID 3265558) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-N,N-diphenylacetamide.
| Compound Name | 2-(4-methylphenyl)sulfonyl-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 3265558 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-N,N-diphenylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO3S/c1-17-12-14-20(15-13-17)26(24,25)16-21(23)22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15H,16H2,1H3 |
| InChIKey | QORKENWDLIQQFY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |