C21H27BrN2O2 — CID 32668029
(2R)-N-[(3-bromo-4-methoxyphenyl)methyl]-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethanamine (PubChem CID 32668029) has the molecular formula C21H27BrN2O2 and a molecular weight of 419.36 g/mol. Its IUPAC name is (2R)-N-[(3-bromo-4-methoxyphenyl)methyl]-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethanamine.
| Compound Name | (2R)-N-[(3-bromo-4-methoxyphenyl)methyl]-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 32668029 |
| Molecular Formula | C21H27BrN2O2 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (2R)-N-[(3-bromo-4-methoxyphenyl)methyl]-2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethanamine |
| SMILES | COc1ccc(CNC[C@@H](c2ccccc2OC)N2CCCC2)cc1Br |
| InChI | InChI=1S/C21H27BrN2O2/c1-25-20-8-4-3-7-17(20)19(24-11-5-6-12-24)15-23-14-16-9-10-21(26-2)18(22)13-16/h3-4,7-10,13,19,23H,5-6,11-12,14-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | NIMKXOGZDYALOX-IBGZPJMESA-N |
| XLogP | 4.39 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |