C19H27NO — CID 32668077
N-(4-methylcyclohexyl)-1-(3-methylphenyl)cyclobutane-1-carboxamide (PubChem CID 32668077) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-1-(3-methylphenyl)cyclobutane-1-carboxamide.
| Compound Name | N-(4-methylcyclohexyl)-1-(3-methylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 32668077 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-(4-methylcyclohexyl)-1-(3-methylphenyl)cyclobutane-1-carboxamide |
| SMILES | Cc1cccc(C2(C(=O)NC3CCC(C)CC3)CCC2)c1 |
| InChI | InChI=1S/C19H27NO/c1-14-7-9-17(10-8-14)20-18(21)19(11-4-12-19)16-6-3-5-15(2)13-16/h3,5-6,13-14,17H,4,7-12H2,1-2H3,(H,20,21) |
| InChIKey | BIRJDFUMXSLYFB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |