C17H22FNO2 — CID 110884708
1-(3-fluorophenyl)-N-(4-hydroxycyclohexyl)cyclobutane-1-carboxamide (PubChem CID 110884708) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-(4-hydroxycyclohexyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-(4-hydroxycyclohexyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 110884708 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-(3-fluorophenyl)-N-(4-hydroxycyclohexyl)cyclobutane-1-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C17H22FNO2/c18-13-4-1-3-12(11-13)17(9-2-10-17)16(21)19-14-5-7-15(20)8-6-14/h1,3-4,11,14-15,20H,2,5-10H2,(H,19,21) |
| InChIKey | OIAQSDGCBFGHBI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |