C15H19FN2O — CID 110469915
1-cyclopropyl-3-[1-(3-fluorophenyl)cyclopentyl]urea (PubChem CID 110469915) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-cyclopropyl-3-[1-(3-fluorophenyl)cyclopentyl]urea.
| Compound Name | 1-cyclopropyl-3-[1-(3-fluorophenyl)cyclopentyl]urea |
|---|---|
| PubChem CID | 110469915 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-cyclopropyl-3-[1-(3-fluorophenyl)cyclopentyl]urea |
| SMILES | O=C(NC1CC1)NC1(c2cccc(F)c2)CCCC1 |
| InChI | InChI=1S/C15H19FN2O/c16-12-5-3-4-11(10-12)15(8-1-2-9-15)18-14(19)17-13-6-7-13/h3-5,10,13H,1-2,6-9H2,(H2,17,18,19) |
| InChIKey | DIQDYKVXSJNMKI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |