C19H23N3O2S — CID 32674724
N-(dicyclopropylmethyl)-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 32674724) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(dicyclopropylmethyl)-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 32674724 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-(dicyclopropylmethyl)-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | COc1cccc(-n2ccnc2SCC(=O)NC(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C19H23N3O2S/c1-24-16-4-2-3-15(11-16)22-10-9-20-19(22)25-12-17(23)21-18(13-5-6-13)14-7-8-14/h2-4,9-11,13-14,18H,5-8,12H2,1H3,(H,21,23) |
| InChIKey | GUHCBHVCSYRBLS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |