C19H27N3O3S — CID 55883837
2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanyl-N-[2-(3-methylbutoxy)ethyl]acetamide (PubChem CID 55883837) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanyl-N-[2-(3-methylbutoxy)ethyl]acetamide.
| Compound Name | 2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanyl-N-[2-(3-methylbutoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 55883837 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanyl-N-[2-(3-methylbutoxy)ethyl]acetamide |
| SMILES | COc1cccc(-n2ccnc2SCC(=O)NCCOCCC(C)C)c1 |
| InChI | InChI=1S/C19H27N3O3S/c1-15(2)7-11-25-12-9-20-18(23)14-26-19-21-8-10-22(19)16-5-4-6-17(13-16)24-3/h4-6,8,10,13,15H,7,9,11-12,14H2,1-3H3,(H,20,23) |
| InChIKey | NOTOPDHMMPXGEW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|