C22H22N4O2S — CID 17435052
N-[2-(1H-indol-3-yl)ethyl]-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 17435052) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 17435052 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | COc1cccc(-n2ccnc2SCC(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C22H22N4O2S/c1-28-18-6-4-5-17(13-18)26-12-11-24-22(26)29-15-21(27)23-10-9-16-14-25-20-8-3-2-7-19(16)20/h2-8,11-14,25H,9-10,15H2,1H3,(H,23,27) |
| InChIKey | BAQQWADKHWOETC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |