C16H24N2O4 — CID 32686708
(3S)-3-acetamido-3-(4-methoxyphenyl)-N-(3-methoxypropyl)propanamide (PubChem CID 32686708) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (3S)-3-acetamido-3-(4-methoxyphenyl)-N-(3-methoxypropyl)propanamide.
| Compound Name | (3S)-3-acetamido-3-(4-methoxyphenyl)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 32686708 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (3S)-3-acetamido-3-(4-methoxyphenyl)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C[C@H](NC(C)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H24N2O4/c1-12(19)18-15(11-16(20)17-9-4-10-21-2)13-5-7-14(22-3)8-6-13/h5-8,15H,4,9-11H2,1-3H3,(H,17,20)(H,18,19)/t15-/m0/s1 |
| InChIKey | HJCJHVYIERZVSM-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|