C13H18N2O5S — CID 95133505
(3S)-3-acetamido-3-(4-methoxyphenyl)-N-methylsulfonylpropanamide (PubChem CID 95133505) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is (3S)-3-acetamido-3-(4-methoxyphenyl)-N-methylsulfonylpropanamide.
| Compound Name | (3S)-3-acetamido-3-(4-methoxyphenyl)-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 95133505 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (3S)-3-acetamido-3-(4-methoxyphenyl)-N-methylsulfonylpropanamide |
| SMILES | COc1ccc([C@H](CC(=O)NS(C)(=O)=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C13H18N2O5S/c1-9(16)14-12(8-13(17)15-21(3,18)19)10-4-6-11(20-2)7-5-10/h4-7,12H,8H2,1-3H3,(H,14,16)(H,15,17)/t12-/m0/s1 |
| InChIKey | LBILOJRFGQRDFX-LBPRGKRZSA-N |
| XLogP | 0.34 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |