C15H13BrN4O2S2 — CID 3269032
N-(4-bromophenyl)-2-[3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 3269032) has the molecular formula C15H13BrN4O2S2 and a molecular weight of 425.33 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 3269032 |
| Molecular Formula | C15H13BrN4O2S2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | N-(4-bromophenyl)-2-[3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CN1C(=O)C(CC(=O)Nc2ccc(Br)cc2)SC1=Nc1nccs1 |
| InChI | InChI=1S/C15H13BrN4O2S2/c1-20-13(22)11(24-15(20)19-14-17-6-7-23-14)8-12(21)18-10-4-2-9(16)3-5-10/h2-7,11H,8H2,1H3,(H,18,21) |
| InChIKey | VBBLAOZFDNQXBT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|