C15H12Cl2N4O2S2 — CID 3975247
N-(3,4-dichlorophenyl)-2-[3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 3975247) has the molecular formula C15H12Cl2N4O2S2 and a molecular weight of 415.33 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 3975247 |
| Molecular Formula | C15H12Cl2N4O2S2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[3-methyl-4-oxo-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CN1C(=O)C(CC(=O)Nc2ccc(Cl)c(Cl)c2)SC1=Nc1nccs1 |
| InChI | InChI=1S/C15H12Cl2N4O2S2/c1-21-13(23)11(25-15(21)20-14-18-4-5-24-14)7-12(22)19-8-2-3-9(16)10(17)6-8/h2-6,11H,7H2,1H3,(H,19,22) |
| InChIKey | STTZIQBYEZLAPC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|