C14H13ClF3N3O2S — CID 42914987
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 42914987) has the molecular formula C14H13ClF3N3O2S and a molecular weight of 379.79 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 42914987 |
| Molecular Formula | C14H13ClF3N3O2S |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | C/N=C1/SC(CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)C(=O)N1C |
| InChI | InChI=1S/C14H13ClF3N3O2S/c1-19-13-21(2)12(23)10(24-13)6-11(22)20-7-3-4-9(15)8(5-7)14(16,17)18/h3-5,10H,6H2,1-2H3,(H,20,22)/b19-13+ |
| InChIKey | SGCMMDDVGOTUHJ-CPNJWEJPSA-N |
| XLogP | 3.25 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|