C29H29N3O4 — CID 3270418
4-(4-benzylpiperidine-1-carbonyl)-2-(3,5-dimethoxyphenyl)phthalazin-1-one (PubChem CID 3270418) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-(4-benzylpiperidine-1-carbonyl)-2-(3,5-dimethoxyphenyl)phthalazin-1-one.
| Compound Name | 4-(4-benzylpiperidine-1-carbonyl)-2-(3,5-dimethoxyphenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 3270418 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 4-(4-benzylpiperidine-1-carbonyl)-2-(3,5-dimethoxyphenyl)phthalazin-1-one |
| SMILES | COc1cc(OC)cc(-n2nc(C(=O)N3CCC(Cc4ccccc4)CC3)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C29H29N3O4/c1-35-23-17-22(18-24(19-23)36-2)32-28(33)26-11-7-6-10-25(26)27(30-32)29(34)31-14-12-21(13-15-31)16-20-8-4-3-5-9-20/h3-11,17-19,21H,12-16H2,1-2H3 |
| InChIKey | AZSGFYFKFZCJSQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |