C28H29N4O3+ — CID 5072242
4-(4-benzylpiperazin-4-ium-1-carbonyl)-2-(4-ethoxyphenyl)phthalazin-1-one (PubChem CID 5072242) has the molecular formula C28H29N4O3+ and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-4-ium-1-carbonyl)-2-(4-ethoxyphenyl)phthalazin-1-one.
| Compound Name | 4-(4-benzylpiperazin-4-ium-1-carbonyl)-2-(4-ethoxyphenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 5072242 |
| Molecular Formula | C28H29N4O3+ |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-(4-benzylpiperazin-4-ium-1-carbonyl)-2-(4-ethoxyphenyl)phthalazin-1-one |
| SMILES | CCOc1ccc(-n2nc(C(=O)N3CC[NH+](Cc4ccccc4)CC3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C28H28N4O3/c1-2-35-23-14-12-22(13-15-23)32-27(33)25-11-7-6-10-24(25)26(29-32)28(34)31-18-16-30(17-19-31)20-21-8-4-3-5-9-21/h3-15H,2,16-20H2,1H3/p+1 |
| InChIKey | XSKYMZDHDLJOGA-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |