C24H29N4O2+ — CID 9109567
2-methyl-4-[4-[(4-propan-2-ylphenyl)methyl]piperazin-4-ium-1-carbonyl]phthalazin-1-one (PubChem CID 9109567) has the molecular formula C24H29N4O2+ and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-methyl-4-[4-[(4-propan-2-ylphenyl)methyl]piperazin-4-ium-1-carbonyl]phthalazin-1-one.
| Compound Name | 2-methyl-4-[4-[(4-propan-2-ylphenyl)methyl]piperazin-4-ium-1-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 9109567 |
| Molecular Formula | C24H29N4O2+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-methyl-4-[4-[(4-propan-2-ylphenyl)methyl]piperazin-4-ium-1-carbonyl]phthalazin-1-one |
| SMILES | CC(C)c1ccc(C[NH+]2CCN(C(=O)c3nn(C)c(=O)c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O2/c1-17(2)19-10-8-18(9-11-19)16-27-12-14-28(15-13-27)24(30)22-20-6-4-5-7-21(20)23(29)26(3)25-22/h4-11,17H,12-16H2,1-3H3/p+1 |
| InChIKey | IZYLZRBMKPATAT-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |