C22H16N4O3S — CID 3271054
2-[[4-(furan-2-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione (PubChem CID 3271054) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3271054 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CSc1nnc(-c2ccccc2)n1Cc1ccco1 |
| InChI | InChI=1S/C22H16N4O3S/c27-20-17-10-4-5-11-18(17)21(28)26(20)14-30-22-24-23-19(15-7-2-1-3-8-15)25(22)13-16-9-6-12-29-16/h1-12H,13-14H2 |
| InChIKey | AWIYSMGQHJHPMB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|